4079 Hypoglycin B Hypoglycin B is a naturally occurring organic compound in the species Blighia sapida. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is a causative agent of Jamaican Vomiting Sickness. It is an amino acid and chemically related to lysine. 502-37-4 441445 C12H18N2O5 White powder. Generally, hypoglycin is an amino acid and chemically related to lysine. It competitively binds to enzymes used in the catabolism of lysine and is the reason why it and its metabolitemethylene cyclopropyl acetic acid (MCPA) are toxic. The metabolite MCPA also is a potent inhibitor of acyl CoA dehydrogenase, preventing the metabolism of fatty acids. No indication of carcinogenicity to humans (not listed by IARC). 2014-08-29T04:49:24Z 2014-12-24T20:26:36Z Hypoglycin B C08280 true [H][C@](N)(CCC(O)=N[C@@]([H])(C[C@]1([H])CC1=C)C(O)=O)C(O)=O C12H18N2O5 InChI=1S/C12H18N2O5/c1-6-4-7(6)5-9(12(18)19)14-10(15)3-2-8(13)11(16)17/h7-9H,1-5,13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-,9-/m0/s1 InChIKey=UYDZYCPIQSRXKU-CIUDSAMLSA-N 270.2817 270.121571696 Exogenous Solid 390178